Systematic / IUPAC Name: 2-[[(3S,3aR,6R,6aS)-3-(Cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide
ID: Reference12646
Other Names:
D-Glucitol, 5-O-(2-amino-2-oxoethyl)-1,4:3,6-dianhydro-2-[[(cyclohexylamino)carbonyl]amino]-2-deoxy-;
NAT6-269367
Formula: C15H25N3O5
5-O-(2-Amino-2-oxoethyl)-1,4:3,6-dianhydro-2-[(cyclohexylcarbamoyl)amino]-2-deoxy-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1272 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/10/2023 1:17:54 PM |
| InChI | InChI=1S/C15H25N3O5/c16-12(19)8-21-11-7-23-13-10(6-22-14(11)13)18-15(20)17-9-4-2-1-3-5-9/h9-11,13-14H,1-8H2,(H2,16,19)(H2,17,18,20)/t10-,11+,13+,14+/m0/s1 |
| InChI Key | RAVYTTOSUDVCDV-OIMNJJJWSA-N |
| Canonical SMILES | C1CCC(CC1)NC(=O)NC2COC3C2OCC3OCC(=O)N |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 5-O-(2-amino-2-oxoethyl)-1,4:3,6-dianhydro-2-[[(cyclohexylamino)carbonyl]amino]-2-deoxy-; NAT6-269367 |