Systematic / IUPAC Name: N-[[(2R,3S,4R)-3-Hydroxy-4-(1H-imidazol-5-ylmethylamino)oxolan-2-yl]methyl]thiophene-2-carboxamide
ID: Reference12673
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(1H-imidazol-4-ylmethyl)amino]-5-[(2-thienylcarbonyl)amino]-;
NAT19-551329
Formula: C14H18N4O3S
1,4-Anhydro-2,5-dideoxy-2-[(1H-imidazol-4-ylmethyl)amino]-5-[(2-thienylcarbonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 943 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/24/2023 4:39:35 PM |
| InChI | InChI=1S/C14H18N4O3S/c19-13-10(16-5-9-4-15-8-18-9)7-21-11(13)6-17-14(20)12-2-1-3-22-12/h1-4,8,10-11,13,16,19H,5-7H2,(H,15,18)(H,17,20)/t10-,11-,13+/m1/s1 |
| InChI Key | XUARAPKKDGGNDT-WZRBSPASSA-N |
| Canonical SMILES | C1C(C(C(O1)CNC(=O)C2=CC=CS2)O)NCC3=CN=CN3 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(1H-imidazol-4-ylmethyl)amino]-5-[(2-thienylcarbonyl)amino]-; NAT19-551329 |