Systematic / IUPAC Name: (3S,3aR,6R,6aR)-3-(5-Cyclopentylsulfanyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol
ID: Reference12704
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-[5-(cyclopentylthio)-1H-tetrazol-1-yl]-2-deoxy-;
NAT6-296181
Formula: C12H18N4O3S
1,4:3,6-Dianhydro-2-[5-(cyclopentylsulfanyl)-1H-tetrazol-1-yl]-2-deoxy-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 625 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/15/2023 8:18:09 AM |
| InChI | InChI=1S/C12H18N4O3S/c17-9-6-19-10-8(5-18-11(9)10)16-12(13-14-15-16)20-7-3-1-2-4-7/h7-11,17H,1-6H2/t8-,9+,10+,11+/m0/s1 |
| InChI Key | UJANXZIBHJDNHX-LNFKQOIKSA-N |
| Canonical SMILES | C1CCC(C1)SC2=NN=NN2C3COC4C3OCC4O |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-[5-(cyclopentylthio)-1H-tetrazol-1-yl]-2-deoxy-; NAT6-296181 |