Systematic / IUPAC Name: (3S,3aR,6S,6aR)-N-Benzyl-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine
ID: Reference12709
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,5-dideoxy-5-[(phenylmethyl)amino]-;
NAT6-306520
Formula: C22H30N4O2
1,4:3,6-Dianhydro-2-(benzylamino)-5-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,5-dideoxy-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1329 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/15/2023 11:14:12 AM |
| InChI | InChI=1S/C22H30N4O2/c1-3-7-16(8-4-1)11-18-13-26(25-24-18)20-15-28-21-19(14-27-22(20)21)23-12-17-9-5-2-6-10-17/h2,5-6,9-10,13,16,19-23H,1,3-4,7-8,11-12,14-15H2/t19-,20-,21+,22+/m0/s1 |
| InChI Key | GFRVNDBWOSRHOR-FNAHDJPLSA-N |
| Canonical SMILES | C1CCC(CC1)CC2=CN(N=N2)C3COC4C3OCC4NCC5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,5-dideoxy-5-[(phenylmethyl)amino]-; NAT6-306520 |