Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(1-Acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]-3,3-dimethylbutanamide
ID: Reference12769
Other Names:
NAT19-551061;
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(3,3-dimethyl-1-oxobutyl)amino]-
Formula: C18H33N3O4
2-[(1-Acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(3,3-dimethylbutanoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2595 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/19/2023 10:49:06 AM |
| InChI | InChI=1S/C18H33N3O4/c1-12(22)21-7-5-13(6-8-21)20-14-11-25-15(17(14)24)10-19-16(23)9-18(2,3)4/h13-15,17,20,24H,5-11H2,1-4H3,(H,19,23)/t14-,15-,17+/m1/s1 |
| InChI Key | HGYNXQZVEXMWJV-INMHGKMJSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)NC2COC(C2O)CNC(=O)CC(C)(C)C |
| CAS | |
| Splash | |
| Other Names |
NAT19-551061; D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(3,3-dimethyl-1-oxobutyl)amino]- |