Systematic / IUPAC Name: 4-Fluoro-N-[[(2R,3S,4R)-3-hydroxy-4-[(4-methylphenyl)methylamino]oxolan-2-yl]methyl]benzamide
ID: Reference12795
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-2-[[(4-methylphenyl)methyl]amino]-;
NAT19-551468
Formula: C20H23FN2O3
1,4-Anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-2-[(4-methylbenzyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1049 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/5/2023 9:39:07 AM |
| InChI | InChI=1S/C20H23FN2O3/c1-13-2-4-14(5-3-13)10-22-17-12-26-18(19(17)24)11-23-20(25)15-6-8-16(21)9-7-15/h2-9,17-19,22,24H,10-12H2,1H3,(H,23,25)/t17-,18-,19+/m1/s1 |
| InChI Key | NVHGPTTWJIQGKK-QRVBRYPASA-N |
| Canonical SMILES | CC1=CC=C(C=C1)CNC2COC(C2O)CNC(=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-2-[[(4-methylphenyl)methyl]amino]-; NAT19-551468 |