Systematic / IUPAC Name: (3,4-Dimethoxyphenyl)acetic acid
ID: Reference1280
Other Names:
Benzeneacetic acid, 3,4-dimethoxy-;
2-(3,4-Dimethoxyphenyl)acetic acid;
Acetic acid, (3,4-dimethoxyphenyl)-;
3,4-(Dimethoxy)benzeneacetic acid;
(3,4-Dimethoxyphenyl)acetate
Formula: C10H12O4
(3,4-Dimethoxyphenyl)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 794 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:55:52 AM |
| InChI | InChI=1S/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12) |
| InChI Key | WUAXWQRULBZETB-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)CC(=O)O)OC |
| CAS | 93403 |
| Splash | |
| Other Names |
Benzeneacetic acid, 3,4-dimethoxy-; 2-(3,4-Dimethoxyphenyl)acetic acid; Acetic acid, (3,4-dimethoxyphenyl)-; 3,4-(Dimethoxy)benzeneacetic acid; (3,4-Dimethoxyphenyl)acetate; Homoveratric acid |