Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-(Cyclobutylamino)-3-hydroxyoxolan-2-yl]methyl]acetamide
ID: Reference12810
Other Names:
D-Arabinitol, 5-(acetylamino)-1,4-anhydro-2-(cyclobutylamino)-2,5-dideoxy-;
NAT19-551005
Formula: C11H20N2O3
5-Acetamido-1,4-anhydro-2-(cyclobutylamino)-2,5-dideoxy-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 834 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/9/2023 11:07:16 AM |
| InChI | InChI=1S/C11H20N2O3/c1-7(14)12-5-10-11(15)9(6-16-10)13-8-3-2-4-8/h8-11,13,15H,2-6H2,1H3,(H,12,14)/t9-,10-,11+/m1/s1 |
| InChI Key | SJHBIBWCKVQUAW-MXWKQRLJSA-N |
| Canonical SMILES | CC(=O)NCC1C(C(CO1)NC2CCC2)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 5-(acetylamino)-1,4-anhydro-2-(cyclobutylamino)-2,5-dideoxy-; NAT19-551005 |