Systematic / IUPAC Name: (2E,6E,10E)-3,7,11,15-Tetramethyl-2,6,10,14-hexadecatetraen-1-yl trihydrogen diphosphate
ID: Reference1288
Other Names:
Diphosphoric acid, mono(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl) ester, (E,E,E)-;
{[Hydroxy({[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]oxy})phosphoryl]oxy}phosphonic acid;
2,6,10,14-Hexadecatetraen-1-ol, 3,7,11,15-tetramethyl-, trihydrogen pyrophosphate, (E,E,E)-;
Geranylgeranyl diphosphate;
(E,E,E)-Geranylgeranyl diphosphate
Formula: C20H36O7P2
Class: Endogenous Metabolites
Geranylgeranyl pyrophosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 189 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 7:38:59 AM |
| InChI | InChI=1S/C20H36O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/b18-11+,19-13+,20-15+ |
| InChI Key | OINNEUNVOZHBOX-QIRCYJPOSA-N |
| Canonical SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)/C)/C)/C)C |
| CAS | 6699203 |
| Splash | |
| Other Names |
Diphosphoric acid, mono(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl) ester, (E,E,E)-; {[Hydroxy({[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]oxy})phosphoryl]oxy}phosphonic acid; 2,6,10,14-Hexadecatetraen-1-ol, 3,7,11,15-tetramethyl-, trihydrogen pyrophosphate, (E,E,E)-; Geranylgeranyl diphosphate; (E,E,E)-Geranylgeranyl diphosphate; All-trans-geranylgeranyl pyrophosphate |
| KEGG | C00353 |
| ChemSpider | 394418 |
| Wikipedia | Geranylgeranyl pyrophosphate |
| ChemIDPlus | 006699203 |
| PubChem | 447277 |
| ChEMBL | CHEMBL1229266 |
| ChEBI | CHEBI:48861 |
| HMDb | HMDB01285 |