Systematic / IUPAC Name: 2,6-Dihydroxybenzoic acid
ID: Reference1289
Other Names:
Benzoic acid, 2,6-dihydroxy-;
6-Hydroxysalicylic acid;
2-Carboxyresorcinol;
2,6-Resorcylic acid
Formula: C7H6O4
Class: Therapeutics/Prescription Drugs
2,6-Dihydroxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:39:44 AM |
| InChI | InChI=1S/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11) |
| InChI Key | AKEUNCKRJATALU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)O)C(=O)O)O |
| CAS | 303071 |
| Splash | |
| Other Names |
Benzoic acid, 2,6-dihydroxy-; 6-Hydroxysalicylic acid; 2-Carboxyresorcinol; 2,6-Resorcylic acid |
| Wikipedia | 2,6-Dihydroxybenzoic acid |
| ChEBI | CHEBI:68465 |
| PubChem | 9338 |
| HMDb | HMDB13676 |
| ChemSpider | 8974 |
| ChEMBL | CHEMBL454808 |
| ChemIDPlus | 000303071; 000935706; 000935717 |