Systematic / IUPAC Name:
ID: Reference12930
Other Names:
1-Amino-2,5-dimethoxybenzene;
2,5-Dimethoxybenzenamine;
Aminohydroquinone dimethyl ether;
Aniline, 2,5-dimethoxy-;
Benzenamine, 2,5-dimethoxy-
Formula: C8H11NO2
2,5-Dimethoxyaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1630 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 3:17:55 PM |
| InChI | InChI=1S/C8H11NO2/c1-10-6-3-4-8(11-2)7(9)5-6/h3-5H,9H2,1-2H3 |
| InChI Key | NAZDVUBIEPVUKE-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=C(C=C1)OC)N |
| CAS | |
| Splash | |
| Other Names |
1-Amino-2,5-dimethoxybenzene; 2,5-Dimethoxybenzenamine; Aminohydroquinone dimethyl ether; Aniline, 2,5-dimethoxy-; Benzenamine, 2,5-dimethoxy-; Imidogen, (2,5-dimethoxyphenyl)- |
| PubChem | 7613; 7613 |
| ChemSpider | CDF-NBM-MJC-58; 13869661 |
| ChemIDPlus | 102567 |
| ChEMBL | CHEMBL1616799 |