Systematic / IUPAC Name: (2E)-3-(3,4-Dimethoxyphenyl)acrylic acid
ID: Reference1294
Other Names:
3,4-Dimethoxycinnamic acid;
Caffeic acid dimethyl ether;
3-(3,4-Dimethoxyphenyl)acrylic acid;
(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoic acid;
trans-3,4-Dimethoxycinnamic acid
; more
Formula: C11H12O4
Class: Endogenous Metabolites
3,4-Dimethoxycinnamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:26:20 AM |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
| InChI Key | HJBWJAPEBGSQPR-GQCTYLIASA-N |
| Canonical SMILES | |
| CAS | 2316269 |
| Splash | |
| Other Names |
3,4-Dimethoxycinnamic acid; Caffeic acid dimethyl ether; 3-(3,4-Dimethoxyphenyl)acrylic acid; (2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoic acid; trans-3,4-Dimethoxycinnamic acid; 3-(3,4-Dimethoxyphenyl)propenoic acid; 2-Propenoic acid, 3-(3,4-dimethoxyphenyl)-, (E)- |
| PubChem | 717531 |
| Wikipedia | 3,4-Dimethoxycinnamic acid |
| HMDb | HMDB34315 |
| ChemSpider | 626174 |
| ChemIDPlus | 014737894 |
| ChEMBL | CHEMBL320295 |