Systematic / IUPAC Name:
ID: Reference12943
Other Names: Benzoic acid, 3-(methylamino)-
Formula: C8H9NO2
3-(Methylamino)benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 988 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/19/2023 12:55:58 PM |
| InChI | InChI=1S/C8H9NO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2-5,9H,1H3,(H,10,11) |
| InChI Key | ZCCNWBPFIBQFQX-UHFFFAOYSA-N |
| Canonical SMILES | CNC1=CC=CC(=C1)C(=O)O |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 3-(methylamino)- |