Systematic / IUPAC Name: 3-(Dimethylamino)benzoic acid
ID: Reference12946
Other Names:
3-(Dimethylamino)benzoate;
3-Dimethylamino benzoic acid;
3-Dimethylaminobenzoic acid;
3-Dimethylamino-benzoic acid;
3-N,N-Dimethylaminobenzoic acid
; more
Formula: C9H11NO2
3-Dimethylaminobenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1083 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/19/2023 2:25:51 PM |
| InChI | InChI=1S/C9H11NO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| InChI Key | NEGFNJRAUMCZMY-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC=CC(=C1)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
3-(Dimethylamino)benzoate; 3-Dimethylamino benzoic acid; 3-Dimethylaminobenzoic acid; 3-Dimethylamino-benzoic acid; 3-N,N-Dimethylaminobenzoic acid; Benzoic acid, 3-(dimethylamino)-; Benzoic acid, m-(dimethylamino)-; m-(Dimethylamino)benzoic acid; m-(N,N'-Dimethylamino)benzoic acid; m-Dimethylaminobenzoic acid; N,N-Dimethyl-m-aminobenzoic acid |
| ChemSpider | 60201 |
| ChEMBL | CHEMBL111877 |
| ChemIDPlus | 000099649 |
| PubChem | 66837 |