Systematic / IUPAC Name: 1-(2,4-Difluorophenyl)-3-[[(2R,3R,4S,5S)-3-[2-(dimethylamino)ethyl-methylamino]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]urea
ID: Reference13004
Other Names:
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[[(2,4-difluorophenyl)amino]carbonyl]amino]-4-[[2-(dimethylamino)ethyl]methylamino]-;
NAT27-401216
Formula: C18H28F2N4O4
2,5-Anhydro-4,6-dideoxy-6-{[(2,4-difluorophenyl)carbamoyl]amino}-4-{[2-(dimethylamino)ethyl](methyl)amino}-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 650 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/9/2024 8:58:44 AM |
| InChI | InChI=1S/C18H28F2N4O4/c1-23(2)6-7-24(3)16-14(28-15(10-25)17(16)26)9-21-18(27)22-13-5-4-11(19)8-12(13)20/h4-5,8,14-17,25-26H,6-7,9-10H2,1-3H3,(H2,21,22,27)/t14-,15+,16+,17-/m1/s1 |
| InChI Key | YVRSTZZOFAZORB-LTIDMASMSA-N |
| Canonical SMILES | CN(C)CCN(C)C1C(OC(C1O)CO)CNC(=O)NC2=C(C=C(C=C2)F)F |
| CAS | |
| Splash | |
| Other Names |
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[[(2,4-difluorophenyl)amino]carbonyl]amino]-4-[[2-(dimethylamino)ethyl]methylamino]-; NAT27-401216 |