Systematic / IUPAC Name: 1H-Indole-2-carboxylic acid
ID: Reference1302
Other Names:
2-Indolecarboxylic acid;
2-Carboxyindole
Formula: C9H7NO2
Class: Endogenous Metabolites
Indole-2-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 370 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:17:54 AM |
| InChI | InChI=1S/C9H7NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12) |
| InChI Key | HCUARRIEZVDMPT-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)O |
| CAS | 1477505 |
| Splash | |
| Other Names |
2-Indolecarboxylic acid; 2-Carboxyindole |
| ChEMBL | CHEMBL278390 |
| ChemIDPlus | 001477505 |
| HMDb | HMDB02285 |
| ChemSpider | 65731 |
| PubChem | 72899 |