Systematic / IUPAC Name: 1H-Indol-3-yl hydrogen sulfate
ID: Reference1303
Other Names:
3-Indoxyl sulfate;
Indoxylsulfuric acid;
3-Sulfooxy-1H-indole;
Indol-3-yl sulphate;
Indoxyl sulphate
Formula: C8H7NO4S
Class: Endogenous Metabolites
3-Indoxyl sulphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 365 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:17:10 AM |
| InChI | InChI=1S/C8H7NO4S/c10-14(11,12)13-8-5-9-7-4-2-1-3-6(7)8/h1-5,9H,(H,10,11,12) |
| InChI Key | BXFFHSIDQOFMLE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)OS(=O)(=O)O |
| CAS | 487945 |
| Splash | |
| Other Names |
3-Indoxyl sulfate; Indoxylsulfuric acid; 3-Sulfooxy-1H-indole; Indol-3-yl sulphate; Indoxyl sulphate |
| PubChem | 10258 |
| ChEBI | CHEBI:43355 |
| ChEMBL | CHEMBL1233636 |
| ChemSpider | 9840 |
| HMDb | HMDB00682 |
| ChemIDPlus | 000487945; 002642377; 001336794 |