Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(4,4-Difluorocyclohexyl)amino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide
ID: Reference13031
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(phenylsulfonyl)amino]-;
NAT19-551613
Formula: C17H24F2N2O4S
1,4-Anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(phenylsulfonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2122 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/23/2024 1:41:29 PM |
| InChI | InChI=1S/C17H24F2N2O4S/c18-17(19)8-6-12(7-9-17)21-14-11-25-15(16(14)22)10-20-26(23,24)13-4-2-1-3-5-13/h1-5,12,14-16,20-22H,6-11H2/t14-,15-,16+/m1/s1 |
| InChI Key | PKDFWPHMNCBGGF-OAGGEKHMSA-N |
| Canonical SMILES | C1CC(CCC1NC2COC(C2O)CNS(=O)(=O)C3=CC=CC=C3)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(phenylsulfonyl)amino]-; NAT19-551613 |