Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(1-Acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide
ID: Reference13033
Other Names:
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-;
NAT19-551611
Formula: C18H27N3O5S
2-[(1-Acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1686 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/23/2024 1:40:40 PM |
| InChI | InChI=1S/C18H27N3O5S/c1-13(22)21-9-7-14(8-10-21)20-16-12-26-17(18(16)23)11-19-27(24,25)15-5-3-2-4-6-15/h2-6,14,16-20,23H,7-12H2,1H3/t16-,17-,18+/m1/s1 |
| InChI Key | RJNXIZVEXKDHRX-KURKYZTESA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)NC2COC(C2O)CNS(=O)(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-; NAT19-551611 |