Systematic / IUPAC Name: 1H-Pyrazolo[3,4-d]pyrimidin-4-ol
ID: Reference1305
Other Names:
4-Hydroxypyrazolopyrimidine;
4-Hydroxy-3,4-pyrazolopyrimidine;
Zyloprim;
Lopurin;
Zyloric
; more
Formula: C5H4N4O
Class: Therapeutics/Prescription Drugs
Allopurinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 208 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:13:00 AM |
| InChI | InChI=1S/C5H4N4O/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10) |
| InChI Key | OFCNXPDARWKPPY-UHFFFAOYSA-N |
| Canonical SMILES | C1=C2C(=NC=NC2=O)NN1 |
| CAS | 315300 |
| Splash | |
| Other Names |
4-Hydroxypyrazolopyrimidine; 4-Hydroxy-3,4-pyrazolopyrimidine; Zyloprim; Lopurin; Zyloric; Milurit; Progout; Atisuril; Bleminol; Uripurinol; Embarin; Foligan; Urosin; Alositol; Anoprolin; Apulonga; Bloxanth; Caplenal; Cellidrin; Epidropal; Suspendol; Uricemil; Xanturat; Adenock; Ailural; Allopur; Allural; Anzief; Apurin; Apurol; Geapur; Hamarin; Lysuron; Uriprim; Urolit; Urtias; Gotax; Remid; Urbol; Ketobun-A; Miniplanor; Takanarumin; Allozym; Aluline; Cosuric; Dabrosin; Dabroson; Gichtex; Hexanuret; Ketanrift; Ledopur; Monarch; Nektrohan; Urobenyl; Aloral; Epuric; Riball; Allo-puren; Dura Al; Allopurinolum; Allohexal; Alopurinol; Urtias 100; Milurite; Purinol; Aloprim; Ailurial; Sigapurol; Uritas; Jenapurinol; Rimapurinol; Allohexan; Alloprin; Allopurin; Allorin; Allpargin; Capurate; Novopurol; Pureduct; Tipuric; Uribenz; Uridocid; Xanthomax; Xanturic; Roucol; Zygout |
| DrugBank | APRD00435 |
| ChEBI | CHEBI:40279 |
| ChEMBL | CHEMBL1467 |
| Wikipedia | Allopurinol |
| ChemIDPlus | 000315300; 017795210; 138230258; 089247621 |
| HMDb | HMDB14581 |
| ChemSpider | 2010 |
| PubChem | 2094 |