Systematic / IUPAC Name: 4-Fluoro-N-[[(2R,3S,4R)-3-hydroxy-4-[(1-methylimidazol-2-yl)methylamino]oxolan-2-yl]methyl]benzamide
ID: Reference13058
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-2-[[(1-methyl-1H-imidazol-2-yl)methyl]amino]-;
NAT19-551484
Formula: C17H21FN4O3
1,4-Anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-2-{[(1-methyl-1H-imidazol-2-yl)methyl]amino}-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 465 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2024 2:04:59 PM |
| InChI | InChI=1S/C17H21FN4O3/c1-22-7-6-19-15(22)9-20-13-10-25-14(16(13)23)8-21-17(24)11-2-4-12(18)5-3-11/h2-7,13-14,16,20,23H,8-10H2,1H3,(H,21,24)/t13-,14-,16+/m1/s1 |
| InChI Key | JZGPKSFRBNDPBQ-FMKPAKJESA-N |
| Canonical SMILES | CN1C=CN=C1CNC2COC(C2O)CNC(=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzoyl)amino]-2-[[(1-methyl-1H-imidazol-2-yl)methyl]amino]-; NAT19-551484 |
| ChEMBL | CHEMBL5025637 |
| ChemSpider | 29858555 |
| PubChem | 75536647 |