Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(1-Acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]-2-methoxyacetamide
ID: Reference13059
Other Names:
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(2-methoxyacetyl)amino]-;
NAT19-551261
Formula: C15H27N3O5
2-[(1-Acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(methoxyacetyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1517 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2024 2:08:08 PM |
| InChI | InChI=1S/C15H27N3O5/c1-10(19)18-5-3-11(4-6-18)17-12-8-23-13(15(12)21)7-16-14(20)9-22-2/h11-13,15,17,21H,3-9H2,1-2H3,(H,16,20)/t12-,13-,15+/m1/s1 |
| InChI Key | GDYOJKHZVVUIBE-NFAWXSAZSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)NC2COC(C2O)CNC(=O)COC |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(2-methoxyacetyl)amino]-; NAT19-551261 |