Systematic / IUPAC Name: (2S)-2-Hydroxysuccinic acid
ID: Reference1311
Other Names:
(2S)-2-Hydroxybutanedioic acid;
L-Hydroxybutanedioic acid;
(-)-Hydroxysuccinic acid;
L-Hydroxysuccinic acid;
L-2-Hydroxybutanedioic acid
; more
Formula: C4H6O5
Class: Endogenous Metabolites Excipients/Additives/Colorants
L-(-)-Malic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/23/2026 3:00:17 PM |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChI Key | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Canonical SMILES | C(C(C(=O)O)O)C(=O)O |
| CAS | 97676 |
| Splash | |
| Other Names |
(2S)-2-Hydroxybutanedioic acid; L-Hydroxybutanedioic acid; (-)-Hydroxysuccinic acid; L-Hydroxysuccinic acid; L-2-Hydroxybutanedioic acid; L-Hydroxysuccinate; Butanedioic acid, 2-hydroxy-, (2S)-; L-Hydroxybutanedioate; S-2-Hydroxybutanedioate; Butanedioic acid, hydroxy-, (2S)-; Apple acid; L-Apple acid; S-(-)-Malic acid; (S)-Malic acid; S-(-)-Malate |
| Wikipedia | Malic_acid |
| PubChem | 222656 |
| ChEMBL | CHEMBL1234046 |
| ChemSpider | 510 |
| HMDb | HMDB00156 |
| KEGG | C00149 |
| ChemIDPlus | 341031547 |
| ChEBI | CHEBI:30797 |