Systematic / IUPAC Name: N-[(3S,3aR,6R,6aS)-6-Phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-phenylpyrimidin-2-amine
ID: Reference13117
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-5-O-(phenylmethyl)-2-[(4-phenyl-2-pyrimidinyl)amino]-;
NAT6-318826
Formula: C23H23N3O3
1,4:3,6-Dianhydro-5-O-benzyl-2-deoxy-2-[(4-phenyl-2-pyrimidinyl)amino]-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 670 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/26/2024 9:56:09 AM |
| InChI | InChI=1S/C23H23N3O3/c1-3-7-16(8-4-1)13-27-20-15-29-21-19(14-28-22(20)21)26-23-24-12-11-18(25-23)17-9-5-2-6-10-17/h1-12,19-22H,13-15H2,(H,24,25,26)/t19-,20+,21+,22+/m0/s1 |
| InChI Key | UBCRRJTYHOCLLC-DXBBTUNJSA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)OCC3=CC=CC=C3)NC4=NC=CC(=N4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-5-O-(phenylmethyl)-2-[(4-phenyl-2-pyrimidinyl)amino]-; NAT6-318826 |