Systematic / IUPAC Name: (2R,3S)-2,3,4-Trihydroxybutanoic acid
ID: Reference1314
Other Names:
Butanoic acid, 2,3,4-trihydroxy-, (R-(R*,S*))-;
Butanoic acid, 2,3,4-trihydroxy-, (2R,3S)-;
Threonate;
Threonic acid
Formula: C4H8O5
Class: Endogenous Metabolites
L-Threonic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 300 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:58:26 AM |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m0/s1 |
| InChI Key | JPIJQSOTBSSVTP-STHAYSLISA-N |
| Canonical SMILES | C(C(C(C(=O)O)O)O)O |
| CAS | 7306969 |
| Splash | |
| Other Names |
Butanoic acid, 2,3,4-trihydroxy-, (R-(R*,S*))-; Butanoic acid, 2,3,4-trihydroxy-, (2R,3S)-; Threonate; Threonic acid |
| ChemSpider | 4573940 |
| Wikipedia | Threonic acid |
| PubChem | 5460407 |
| ChEBI | CHEBI:15908 |
| KEGG | C01620 |
| ChEMBL | CHEMBL2152047 |