Systematic / IUPAC Name: 3-[5-(Aminomethyl)-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid
ID: Reference1330
Other Names:
5-(Aminomethyl)-4-(carboxymethyl)-pyrrole-3-propionic acid;
5-(Aminomethyl)-4-(carboxymethyl)-1H-pyrrole-3-propionic acid;
5-(Aminomethyl)-4-(carboxymethyl)-pyrrole-3-propionate
Formula: C10H14N2O4
Class: Endogenous Metabolites
Porphobilinogen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 189 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:38:09 AM |
| InChI | InChI=1S/C10H14N2O4/c11-4-8-7(3-10(15)16)6(5-12-8)1-2-9(13)14/h5,12H,1-4,11H2,(H,13,14)(H,15,16) |
| InChI Key | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C(=C(N1)CN)CC(=O)O)CCC(=O)O |
| CAS | 487901 |
| Splash | |
| Other Names |
5-(Aminomethyl)-4-(carboxymethyl)-pyrrole-3-propionic acid; 5-(Aminomethyl)-4-(carboxymethyl)-1H-pyrrole-3-propionic acid; 5-(Aminomethyl)-4-(carboxymethyl)-pyrrole-3-propionate |
| HMDb | HMDB00245 |
| ChemSpider | 995 |
| KEGG | C00931 |
| ChemIDPlus | 000487901 |
| PubChem | 1021 |
| Wikipedia | Porphobilinogen |
| ChEBI | CHEBI:17381 |