Systematic / IUPAC Name: Dipropan-2-yl 5-nitrobenzene-1,3-dicarboxylate
ID: Reference13320
Other Names:
1,3-Benzenedicarboxylic acid, 5-nitro-, bis(1-methylethyl) ester;
Bis(1-methylethyl) 5-nitro-1,3-benzenedicarboxylate;
Diisopropyl 5-nitroisophthalate;
Isophthalic acid, 5-nitro-, diisopropyl ester;
Nitrothale-isopropyl
; more
Formula: C14H17NO6
Class: Pesticides/Herbicides
Nitrothal-isopropyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1731 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/10/2025 1:43:30 PM |
| InChI | InChI=1S/C14H17NO6/c1-8(2)20-13(16)10-5-11(14(17)21-9(3)4)7-12(6-10)15(18)19/h5-9H,1-4H3 |
| InChI Key | VJAWBEFMCIINFU-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)OC(C)C |
| CAS | |
| Splash | |
| Other Names |
1,3-Benzenedicarboxylic acid, 5-nitro-, bis(1-methylethyl) ester; Bis(1-methylethyl) 5-nitro-1,3-benzenedicarboxylate; Diisopropyl 5-nitroisophthalate; Isophthalic acid, 5-nitro-, diisopropyl ester; Nitrothale-isopropyl; Nitrothol isopropyl; AA-1548 |
| ChemSpider | 39827 |
| ChEBI | CHEBI:82026 |
| PubChem | 43704 |
| ChEMBL | CHEMBL1892508 |
| KEGG | C18873 |