Systematic / IUPAC Name: (4-Chlorophenyl)methyl N-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanimidothioate
ID: Reference13323
Other Names:
Manage;
(4-Chlorophenyl)methyl N-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanimidothioate;
1H-1,2,4-Triazole-1-ethanamidothioic acid, N-(2,4-dichlorophenyl)-, (4-chlorophenyl)methyl ester;
1H-1,2,4-Triazole-1-ethanimidothioic acid, N-(2,4-dichlorophenyl)-, (4-chlorophenyl)methyl ester;
4-Chlorobenzyl N-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanimidothioate
; more
Formula: C17H13Cl3N4S
Class: Pesticides/Herbicides
Imibenconazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2564 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2025 8:07:52 PM |
| InChI | InChI=1S/C17H13Cl3N4S/c18-13-3-1-12(2-4-13)9-25-17(8-24-11-21-10-22-24)23-16-6-5-14(19)7-15(16)20/h1-7,10-11H,8-9H2 |
| InChI Key | AGKSTYPVMZODRV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CSC(=NC2=C(C=C(C=C2)Cl)Cl)CN3C=NC=N3)Cl |
| CAS | |
| Splash | |
| Other Names |
Manage; (4-Chlorophenyl)methyl N-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanimidothioate; 1H-1,2,4-Triazole-1-ethanamidothioic acid, N-(2,4-dichlorophenyl)-, (4-chlorophenyl)methyl ester; 1H-1,2,4-Triazole-1-ethanimidothioic acid, N-(2,4-dichlorophenyl)-, (4-chlorophenyl)methyl ester; 4-Chlorobenzyl N-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanimidothioate; 4-Chlorobenzyl N-2,4-dichlorophenyl-2-(1H-1,2,4-triazol-1-yl)thioacetamidate; AA-1557 |
| ChEBI | CHEBI:81767 |
| ChemSpider | 21257418 |
| PubChem | 93483 |