Systematic / IUPAC Name: (2,4-Dichlorophenoxy)-ethoxy-propylsulfanyl-sulfanylidene-λ5-phosphane
ID: Reference13344
Other Names: AA-1526
Formula: C11H15Cl2O2PS2
Class: Pesticides/Herbicides
Prothiofos mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 4579 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/20/2025 2:12:14 PM |
| InChI | InChI=1S/C11H15Cl2O2PS2/c1-3-7-18-16(17,14-4-2)15-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChI Key | FITIWKDOCAUBQD-UHFFFAOYSA-N |
| Canonical SMILES | CCCSP(=S)(OCC)OC1=C(C=C(C=C1)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | AA-1526 |
| PubChem | 36870 |