Systematic / IUPAC Name: N-[Ethoxy-(3-methyl-4-methylsulfinylphenoxy)phosphoryl]propan-2-amine
ID: Reference13362
Other Names:
Fenamiphos sulfoxide;
AA-1798
Formula: C13H22NO4PS
Fenamiphos-sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 6686 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7, MS8 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2025 4:33:42 PM |
| InChI | InChI=1S/C13H22NO4PS/c1-6-17-19(15,14-10(2)3)18-12-7-8-13(20(5)16)11(4)9-12/h7-10H,6H2,1-5H3,(H,14,15) |
| InChI Key | LUQMWGMGWJEGAT-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=O)(NC(C)C)OC1=CC(=C(C=C1)S(=O)C)C |
| CAS | |
| Splash | |
| Other Names |
Fenamiphos sulfoxide; AA-1798 |
| PubChem | 36027 |