Systematic / IUPAC Name: 6-Methyl-[1,3]dithiolo[4,5-b]quinoxalin-2-one
ID: Reference13380
Other Names: Oxythioquinox
Formula: C10H6N2OS2
Class: Pesticides/Herbicides
Chinomethionat mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 520 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2025 8:01:38 PM |
| InChI | InChI=1S/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |
| InChI Key | FBQQHUGEACOBDN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C3C(=N2)SC(=O)S3 |
| CAS | |
| Splash | |
| Other Names | Oxythioquinox |
| PubChem | 17109 |