Systematic / IUPAC Name: 2-Methylpropanedioic acid
ID: Reference1339
Other Names:
2-Methylmalonic acid;
Propanedioic acid, methyl-;
Malonic acid, methyl-;
1,1-Ethanedicarboxylic acid;
Methylpropanedioic acid
; more
Formula: C4H6O4
Class: Endogenous Metabolites
Methylmalonic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 321 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:24:58 AM |
| InChI | InChI=1S/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8) |
| InChI Key | ZIYVHBGGAOATLY-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)C(=O)O |
| CAS | 516052 |
| Splash | |
| Other Names |
2-Methylmalonic acid; Propanedioic acid, methyl-; Malonic acid, methyl-; 1,1-Ethanedicarboxylic acid; Methylpropanedioic acid; Methylpropanedioate; 2-Methylmalonate; α-Methylmalonic acid; Isosuccinic acid |
| PubChem | 487 |
| ChemIDPlus | 000516052 |
| ChemSpider | 473 |
| Wikipedia | Methylmalonic acid |
| KEGG | C02170 |
| ChEMBL | CHEMBL1232416 |
| ChEBI | CHEBI:30860 |
| HMDb | HMDB00202 |