Systematic / IUPAC Name: 2-(4-Chloro-2-oxo-1,3-benzothiazol-3-yl)acetic acid
ID: Reference13413
Other Names: AA-1768
Formula: C9H6ClNO3S
Class: Pesticides/Herbicides
Benazolin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2746 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/13/2025 8:30:19 AM |
| InChI | InChI=1S/C9H6ClNO3S/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6/h1-3H,4H2,(H,12,13) |
| InChI Key | HYJSGOXICXYZGS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C(=C1)Cl)N(C(=O)S2)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-1768 |
| PubChem | 19662 |