Systematic / IUPAC Name: 2,3,7,8-Tetrahydroxychromeno[5,4,3-cde]chromene-5,10-dione
ID: Reference1345
Other Names:
Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2,3,7,8-tetrahydroxy-;
Ellagic acid;
Benzoaric acid;
Lagistase;
Alizarine yellow
; more
Formula: C14H6O8
Class: Endogenous Metabolites
Ellagic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3379 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:14:35 AM |
| InChI | InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
| InChI Key | AFSDNFLWKVMVRB-UHFFFAOYSA-N |
| Canonical SMILES | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O |
| CAS | 476664 |
| Splash | |
| Other Names |
Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2,3,7,8-tetrahydroxy-; Ellagic acid; Benzoaric acid; Lagistase; Alizarine yellow; Elagostasine; Ellagate; Llagate |
| ChEMBL | CHEMBL6246 |
| PubChem | 5281855 |
| KEGG | C10788 |
| ChEBI | CHEBI:4775 |
| ChemIDPlus | 000476664 |
| ChemSpider | 4445149 |
| Wikipedia | Ellagic acid |
| HMDb | HMDB02899 |