Systematic / IUPAC Name: 3-(2,4-Dichlorophenyl)-6-fluoro-2-(1,2,4-triazol-1-yl)quinazolin-4-one
ID: Reference13459
Other Names: AA-1879
Formula: C16H8Cl2FN5O
Class: Pesticides/Herbicides
Fluquinconazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1399 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/17/2025 1:54:48 PM |
| InChI | InChI=1S/C16H8Cl2FN5O/c17-9-1-4-14(12(18)5-9)24-15(25)11-6-10(19)2-3-13(11)22-16(24)23-8-20-7-21-23/h1-8H |
| InChI Key | IJJVMEJXYNJXOJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=C1F)C(=O)N(C(=N2)N3C=NC=N3)C4=C(C=C(C=C4)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | AA-1879 |
| PubChem | 86417 |