Systematic / IUPAC Name: Propan-2-yl N-(3-chlorophenyl)carbamate
ID: Reference13506
Other Names:
Isopropyl N-(3-chlorophenyl)carbamate;
AA-2162
Formula: C10H12ClNO2
Class: Pesticides/Herbicides
Chlorpropham mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 205 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2025 12:44:07 PM |
| InChI | InChI=1S/C10H12ClNO2/c1-7(2)14-10(13)12-9-5-3-4-8(11)6-9/h3-7H,1-2H3,(H,12,13) |
| InChI Key | CWJSHJJYOPWUGX-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)Nc1cccc(Cl)c1 |
| CAS | |
| Splash | |
| Other Names |
Isopropyl N-(3-chlorophenyl)carbamate; AA-2162 |
| ChEBI | CHEBI:34630 |
| Wikipedia | Chlorpropham |
| ChEMBL | CHEMBL104560 |
| PubChem | 2728 |
| ChemSpider | 2627 |
| KEGG | C14506 |