Systematic / IUPAC Name: 2-Methylbenzoic acid
ID: Reference1351
Other Names:
o-Methylbenzoic acid;
Benzoic acid, methyl-;
Toluic acid;
Orthotoluic acid;
o-Toluylic acid
Formula: C8H8O2
Class: Industrial Chemicals
2-Methylbenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:03:58 AM |
| InChI | InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10) |
| InChI Key | ZWLPBLYKEWSWPD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=CC=C1C(=O)O |
| CAS | 118901 |
| Splash | |
| Other Names |
o-Methylbenzoic acid; Benzoic acid, methyl-; Toluic acid; Orthotoluic acid; o-Toluylic acid; 2-Toluic acid |
| HMDb | HMDB02340 |
| ChEBI | CHEBI:36632 |
| ChemSpider | 8070 |
| Wikipedia | O-Toluic acid |
| ChemIDPlus | 000118901; 025567106; 052337776; 052337787; 027476273; 042978778 |
| PubChem | 8373 |
| KEGG | C07215 |
| ChEMBL | CHEMBL114957 |