Systematic / IUPAC Name: 3,6-Dichloro-2-methoxybenzoic acid
ID: Reference13520
Other Names: AA-2183
Formula: C8H6Cl2O3
Class: Pesticides/Herbicides
Dicamba mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 753 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 9:15:29 AM |
| InChI | InChI=1S/C8H6Cl2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3H,1H3,(H,11,12) |
| InChI Key | IWEDIXLBFLAXBO-UHFFFAOYSA-N |
| Canonical SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2183 |
| PubChem | 3030 |
| Wikipedia | Dicamba |
| ChEBI | CHEBI:81856 |
| KEGG | C18597 |
| ChEMBL | CHEMBL476936 |
| ChemSpider | 2922 |