Systematic / IUPAC Name: 2,2-Dimethyl-3H-1-benzofuran-7-ol
ID: Reference13531
Other Names:
Carbofuran phenolCarbofuran phenol;
AA-2017
Formula: C10H12O2
Class: Pesticides/Herbicides
Carbofuran 7-phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 698 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 11:15:31 AM |
| InChI | InChI=1S/C10H12O2/c1-10(2)6-7-4-3-5-8(11)9(7)12-10/h3-5,11H,6H2,1-2H3 |
| InChI Key | WJGPNUBJBMCRQH-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C)Cc2cccc(O)c2O1 |
| CAS | |
| Splash | |
| Other Names |
Carbofuran phenolCarbofuran phenol; AA-2017 |
| ChEBI | CHEBI:38474 |
| PubChem | 15278 |
| ChemSpider | 14543 |
| ChEMBL | CHEMBL2259976 |