Systematic / IUPAC Name: (4-Chlorophenyl)urea
ID: Reference13552
Other Names: AA-2497
Formula: C7H7ClN2O
Class: Pesticides/Herbicides
4-Chlorophenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 285 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 9:00:49 AM |
| InChI | InChI=1S/C7H7ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| InChI Key | RECCURWJDVZHIH-UHFFFAOYSA-N |
| Canonical SMILES | NC(=O)Nc1ccc(Cl)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2497 |
| ChEMBL | CHEMBL1544569 |
| PubChem | 8796 |
| ChemSpider | 8466 |