Systematic / IUPAC Name: (3-Pentan-3-ylphenyl) N-methylcarbamate
ID: Reference13554
Other Names:
m-(1-Ethylpropyl)phenyl methylcarbamate;
AA-2075
Formula: C13H19NO2
Class: Pesticides/Herbicides
3-(3-Pentanyl)phenyl methylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 881 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 9:21:27 AM |
| InChI | InChI=1S/C13H19NO2/c1-4-10(5-2)11-7-6-8-12(9-11)16-13(15)14-3/h6-10H,4-5H2,1-3H3,(H,14,15) |
| InChI Key | SMSFWBAOKCZZBF-UHFFFAOYSA-N |
| Canonical SMILES | CCC(CC)c1cccc(OC(=O)NC)c1 |
| CAS | |
| Splash | |
| Other Names |
m-(1-Ethylpropyl)phenyl methylcarbamate; AA-2075 |