Systematic / IUPAC Name: 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid
ID: Reference13583
Other Names: AA-2357
Formula: C15H12Cl2O4
Class: Pesticides/Herbicides
Diclofop mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1028 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/3/2025 9:12:53 AM |
| InChI | InChI=1S/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19) |
| InChI Key | OOLBCHYXZDXLDS-UHFFFAOYSA-N |
| Canonical SMILES | CC(Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2357 |
| PubChem | 38687 |
| ChEBI | CHEBI:145406 |
| KEGG | C18716 |
| ChEMBL | CHEMBL2288781 |
| ChemSpider | 35447 |