Systematic / IUPAC Name:
ID: Reference13589
Other Names: AA-2404
Formula: C7H4ClFO2
Class: Pesticides/Herbicides
2-Chloro-6-fluorobenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 225 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/6/2025 8:42:19 AM |
| InChI | InChI=1S/C7H4ClFO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) |
| InChI Key | XNTIGDVFBDJLTQ-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1c(F)cccc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2404 |
| ChemSpider | 61264 |
| ChEMBL | CHEMBL578940 |
| PubChem | 67947 |