Systematic / IUPAC Name: 4-Amino-1-(2-deoxy-5-o-phosphonopentofuranosyl)-2(1H)-pyrimidinone
ID: Reference136
Other Names:
[5-(4-Amino-2-oxohydropyrimidinyl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;
dCMP;
Deoxycytidine monophosphate;
Deoxycytidine-5'-monophosphoric acid
Formula: C9H14N3O7P
Class: Endogenous Metabolites
2'-Deoxycytidine 5'-monophosphate (dCMP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 202 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/6/2014 9:31:29 AM |
| InChI | InChI=1S/C9H14N3O7P/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(19-8)4-18-20(15,16)17/h1-2,5-6,8,13H,3-4H2,(H2,10,11,14)(H2,15,16,17) |
| InChI Key | NCMVOABPESMRCP-UHFFFAOYSA-N |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)O)O |
| CAS | 1032651 |
| Splash | |
| Other Names |
[5-(4-Amino-2-oxohydropyrimidinyl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate; dCMP; Deoxycytidine monophosphate; Deoxycytidine-5'-monophosphoric acid |