Systematic / IUPAC Name: Ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-λ5-phosphane
ID: Reference13607
Other Names:
Ethyl p-nitrophenyl benzenethiophosphonate;
AA-2412
Formula: C14H14NO4PS
Class: Pesticides/Herbicides
EPN mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 629 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/20/2025 8:08:06 AM |
| InChI | InChI=1S/C14H14NO4PS/c1-2-18-20(21,14-6-4-3-5-7-14)19-13-10-8-12(9-11-13)15(16)17/h3-11H,2H2,1H3 |
| InChI Key | AIGRXSNSLVJMEA-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=S)(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| CAS | |
| Splash | |
| Other Names |
Ethyl p-nitrophenyl benzenethiophosphonate; AA-2412 |
| ChEMBL | CHEMBL3184641 |
| KEGG | C14434 |
| ChEBI | CHEBI:34733 |
| ChemSpider | 15571 |
| PubChem | 16421 |