Systematic / IUPAC Name:
ID: Reference13634
Other Names: AA-2552
Formula: C9H11ClN2O
Class: Pesticides/Herbicides
1-(3-Chloro-4-methylphenyl)-3-methylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 385 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/10/2025 12:52:28 PM |
| InChI | InChI=1S/C9H11ClN2O/c1-6-3-4-7(5-8(6)10)12-9(13)11-2/h3-5H,1-2H3,(H2,11,12,13) |
| InChI Key | GUMFWXBSFOHZDC-UHFFFAOYSA-N |
| Canonical SMILES | CNC(=O)Nc1ccc(C)c(Cl)c1 |
| CAS | |
| Splash | |
| Other Names | AA-2552 |