Systematic / IUPAC Name: (3S,4R,5R)-1,4,5,6-Tetrahydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one
ID: Reference13636
Other Names: Turanose
Formula: C12H22O11
Class: Endogenous Metabolites Excipients/Additives/Colorants
D-(+)-Turanose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1648 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/7/2025 10:59:44 AM |
| InChI | InChI=1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4,6-16,18-21H,1-3H2/t4-,6-,7-,8-,9+,10-,11-,12-/m1/s1 |
| InChI Key | RULSWEULPANCDV-PIXUTMIVSA-N |
| Canonical SMILES | O=C(CO)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CO |
| CAS | |
| Splash | |
| Other Names | Turanose |