Systematic / IUPAC Name:
ID: Reference13644
Other Names: AA-2561
Formula: C7H8N2O
Class: Pesticides/Herbicides
Phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 285 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 11:07:01 AM |
| InChI | InChI=1S/C7H8N2O/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChI Key | LUBJCRLGQSPQNN-UHFFFAOYSA-N |
| Canonical SMILES | NC(=O)Nc1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-2561 |
| ChemSpider | 5915 |
| HMDb | HMDB0062267 |
| PubChem | 6145 |
| ChEMBL | CHEMBL168445 |