Systematic / IUPAC Name:
ID: Reference13645
Other Names: AA-2562
Formula: C6H6ClN
Class: Pesticides/Herbicides
3-Chloroaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 115 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 11:05:26 AM |
| InChI | InChI=1S/C6H6ClN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
| InChI Key | PNPCRKVUWYDDST-UHFFFAOYSA-N |
| Canonical SMILES | Nc1cccc(Cl)c1 |
| CAS | |
| Splash | |
| Other Names | AA-2562 |
| ChemSpider | 560; 13869451 |
| PubChem | 7932 |
| ChEMBL | CHEMBL325415 |