Systematic / IUPAC Name: 2,3,4,5,6-Pentachloroaniline
ID: Reference13657
Other Names: AA-2567
Formula: C6H2Cl5N
Class: Pesticides/Herbicides
Pentachloroaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 159 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 10:50:57 AM |
| InChI | InChI=1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChI Key | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| Canonical SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2567 |
| ChemSpider | 10243 |
| ChEMBL | CHEMBL1904605 |
| PubChem | 10693 |